![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/a.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/tex.gif){kind=icon}
![[ ]](/icons/dvi.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| "PRL37902.ps.gz" | 12-Sep-2005 11:30 | 171K | |
| 0011042 | 12-Sep-2005 11:29 | 128K | |
| 0107082-A classical ..> | 12-Sep-2005 11:30 | 180K | |
| 0110193 | 12-Sep-2005 11:29 | 94K | |
| 0201042General-purpo..> | 12-Sep-2005 11:30 | 415K | |
| 0204065-Efficient cl..> | 12-Sep-2005 11:30 | 97K | |
| 0207068NumsimInfrec.pdf | 12-Sep-2005 11:30 | 507K | |
| 0207118-From CBits t..> | 12-Sep-2005 11:30 | 2.0K | |
| 0207118-fromcbitstoq..> | 12-Sep-2005 11:30 | 141K | |
| 0207144-Quantum limi..> | 12-Sep-2005 11:30 | 97K | |
| 0208003-Gate-level S..> | 12-Sep-2005 11:30 | 209K | |
| 0209095.ps | 27-Oct-2006 11:18 | 264K | |
| 0211114 | 12-Sep-2005 11:29 | 83K | |
| 0212029-cloning of q..> | 12-Sep-2005 11:30 | 80K | |
| 0705.1928.ps | 15-May-2007 12:55 | 717K | |
| A (5, 5) and (6, 6) ..> | 13-Mar-2007 10:58 | 135K | |
| Acaoe.ps | 07-Oct-2005 13:58 | 180K | |
| A classical analogue..> | 12-Sep-2005 11:30 | 180K | |
| A class of bound ent..> | 21-Dec-2006 09:13 | 104K | |
| Adiabatic quantum co..> | 12-Sep-2005 11:30 | 123K | |
| Affine.pdf | 07-Oct-2005 13:27 | 23K | |
| Affine maps of densi..> | 12-Sep-2005 11:30 | 23K | |
| An experimental test..> | 24-Apr-2007 08:31 | 307K | |
| Are the Laws of Enta..> | 12-Sep-2005 11:30 | 89K | |
| A small trapped-ion ..> | 07-Mar-2007 10:21 | 422K | |
| Auerbach.pdf | 12-Sep-2005 11:29 | 1.4M | |
| AvhandlingPhD.pdf | 25-May-2007 14:06 | 2.2M | |
| BengtssonIntroToEnta..> | 03-Nov-2006 09:56 | 1.0M | |
| Bertlmann2002.pdf | 12-Sep-2005 11:32 | 140K | |
| Bertlmann2004 | 12-Sep-2005 11:32 | 532K | |
| BertlmannOptimalEW.pdf | 17-Nov-2005 10:55 | 252K | |
| Binegativity and geo..> | 12-Sep-2005 11:30 | 134K | |
| BoundEntanglement.pdf | 07-Oct-2005 13:20 | 126K | |
| CP^n, or, entangleme..> | 12-Sep-2005 11:30 | 787K | |
| CPn, or, entanglemen..> | 12-Sep-2005 11:30 | 62K | |
| Can quantum mechanic..> | 16-Apr-2007 14:01 | 618K | |
| Classical sim supers..> | 12-Sep-2005 11:30 | 244K | |
| Class of positive pa..> | 21-Dec-2006 09:04 | 95K | |
| Clauser-Horne inequa..> | 12-Sep-2005 11:30 | 93K | |
| Cloning of qubits of..> | 12-Sep-2005 11:30 | 80K | |
| Cmoe.pdf | 07-Oct-2005 13:15 | 138K | |
| Comment on "Quantum ..> | 07-Mar-2007 09:28 | 104K | |
| Communication cost o..> | 17-Nov-2005 10:13 | 155K | |
| Computable measure o..> | 12-Sep-2005 11:30 | 138K | |
| Concentrating partia..> | 12-Sep-2005 11:30 | 143K | |
| Conditions for a Cla..> | 12-Sep-2005 11:30 | 60K | |
| Construction of 3 ot..> | 21-Dec-2006 09:23 | 138K | |
| Construction of boun..> | 13-Mar-2007 13:08 | 129K | |
| Construction of quan..> | 12-Dec-2005 12:58 | 33K | |
| Cpeblo.pdf | 07-Oct-2005 12:57 | 143K | |
| DMRGreview.pdf | 12-Sep-2005 11:30 | 587K | |
| Decoherence of matte..> | 07-Mar-2007 09:25 | 295K | |
| Distinguishing separ..> | 12-Dec-2005 11:57 | 93K | |
| Efficient classical ..> | 12-Sep-2005 11:30 | 97K | |
| Efficient distillati..> | 12-Sep-2005 11:30 | 107K | |
| EisertPlenio2002.pdf | 12-Sep-2005 11:32 | 115K | |
| EisertPlenio2003.pdf | 12-Sep-2005 11:32 | 367K | |
| Entangled Maxwell's ..> | 12-Sep-2005 11:30 | 241K | |
| Entangled states wit..> | 21-Dec-2006 09:30 | 143K | |
| EntanglementOfFormat..> | 17-Nov-2005 10:09 | 92K | |
| Entanglement and the..> | 12-Sep-2005 11:30 | 167K | |
| Entanglement entropy..> | 12-Sep-2005 11:30 | 99K | |
| Entanglement generat..> | 29-Sep-2005 15:37 | 202K | |
| Entanglement measure..> | 12-Sep-2005 11:30 | 307K | |
| Entanglement of supe..> | 19-Sep-2006 09:10 | 97K | |
| Entanglement propert..> | 19-Sep-2006 09:02 | 146K | |
| Experimental demonst..> | 12-Sep-2005 11:30 | 408K | |
| Forskjellige mål på ..> | 12-Sep-2005 11:30 | - | |
| Free-Space distribut..> | 07-Mar-2007 11:51 | 374K | |
| From CBits to QBits...> | 12-Sep-2005 11:30 | 2.0K | |
| Fromcbitstoqubits.ps | 12-Sep-2005 11:30 | 141K | |
| Fundamentals of Quan..> | 12-Sep-2005 11:30 | 1.2M | |
| Gate-level Simulatio..> | 12-Sep-2005 11:30 | 209K | |
| General-purpose para..> | 12-Sep-2005 11:30 | 415K | |
| Geomentanglement/ | 06-Oct-2005 14:06 | - | |
| Geometric Quantum Me..> | 12-Sep-2005 11:32 | 445K | |
| Geometric Quantum Me..> | 12-Sep-2005 11:32 | 502K | |
| Geometry and Product..> | 12-Sep-2005 11:30 | 169K | |
| Geometry of density ..> | 12-Sep-2005 11:32 | 1.1M | |
| Geometry of density ..> | 12-Sep-2005 11:32 | 1.8M | |
| Geometry of density ..> | 12-Sep-2005 11:32 | 2.1M | |
| Geometry of density ..> | 12-Sep-2005 11:32 | 1.7M | |
| Group-theoretical ap..> | 19-Sep-2006 09:06 | 160K | |
| Harshman.pdf | 02-Oct-2006 12:24 | 121K | |
| Height of separable ..> | 17-Nov-2005 10:51 | 169K | |
| HorodeckiDec04pdf.pdf | 12-Sep-2005 11:30 | 92K | |
| How the first partia..> | 28-Mar-2006 13:38 | 70K | |
| How to mix a density..> | 12-Sep-2005 11:30 | 77K | |
| Hulpke2005.pdf | 07-Nov-2005 12:39 | 102K | |
| Infrastructure for t..> | 07-Mar-2007 10:14 | 710K | |
| Introduction to NMR ..> | 12-Sep-2005 11:30 | 416K | |
| Introduction to Quan..> | 12-Sep-2005 11:30 | 396K | |
| Introduction to quan..> | 12-Sep-2005 11:30 | 142K | |
| Ioannou.pdf | 20-Jun-2006 09:02 | 116K | |
| IoannouAlgorithm.pdf | 28-Mar-2006 13:02 | 191K | |
| IoannouComplexity.pdf | 30-Mar-2006 15:11 | 472K | |
| Irreversibility for ..> | 17-Nov-2005 10:19 | 90K | |
| JMO49(1277).pdf | 06-Oct-2005 14:21 | 646K | |
| JMathPhys_43_4237.pdf | 28-Mar-2006 13:11 | 134K | |
| KnillQuantumSimulati..> | 12-Sep-2005 11:30 | 332K | |
| Largest separable ba..> | 12-Sep-2005 11:32 | 160K | |
| Lecture5.pdf | 12-Sep-2005 11:29 | 1.3M | |
| LinAlgSeparability.pdf | 12-Dec-2005 15:26 | 200K | |
| Monge Metric on the ..> | 12-Sep-2005 11:32 | 626K | |
| Monge Metric on the ..> | 12-Sep-2005 11:32 | 1.4M | |
| Myhr.pdf | 12-Sep-2005 11:32 | 524K | |
| NP-hard.pdf | 06-Mar-2007 10:09 | 408K | |
| NRMQC.pdf | 04-Sep-2006 10:08 | 1.3M | |
| Non-full-rank bound ..> | 21-Dec-2006 09:26 | 82K | |
| NumsimInfrec.pdf | 12-Sep-2005 11:30 | 507K | |
| Oppgave Prosjekt/ | 12-Sep-2005 11:30 | - | |
| Optomechanical Entan..> | 07-Mar-2007 11:47 | 247K | |
| Other/ | 12-Sep-2005 11:30 | - | |
| OvrumThesis.pdf | 22-May-2007 13:26 | 2.2M | |
| Ozawa.pdf | 12-Sep-2005 11:32 | 41K | |
| PairingInAll.pdf | 12-Sep-2006 09:00 | 50K | |
| Photonic entanglemen..> | 07-Mar-2007 11:46 | 231K | |
| PhysRevA_71_052327.pdf | 12-Sep-2005 11:30 | 106K | |
| PhysRevA_73_052324.pdf | 20-Jun-2006 12:51 | 300K | |
| PhysRevA_74_012313.pdf | 18-Apr-2007 14:13 | 333K | |
| Physical-resource de..> | 12-Sep-2005 11:30 | 233K | |
| Preserving entanglem..> | 12-Sep-2005 11:30 | 62K | |
| Probability analysis..> | 12-Sep-2005 11:30 | 197K | |
| Programmable quantum..> | 12-Sep-2005 11:30 | 156K | |
| QCTheUltimateFrontier | 12-Sep-2005 11:30 | 75K | |
| QC and many body phy..> | 30-Mar-2006 15:31 | 2.0M | |
| QCenemyCamp | 12-Sep-2005 11:30 | 157K | |
| QCwQuaipartFracQuant..> | 12-Sep-2005 11:30 | 126K | |
| QINFO-zhou-leung-chu..> | 12-Sep-2005 11:30 | 183K | |
| QM-bokGeometry of Qu..> | 12-Sep-2005 11:30 | 23M | |
| Quantifying Entangle..> | 12-Sep-2005 11:32 | 136K | |
| Quantum Computers ex..> | 12-Sep-2005 11:30 | 131K | |
| Quantum Information ..> | 12-Sep-2005 11:30 | 125K | |
| Quantum Mechanics He..> | 18-Apr-2007 13:55 | 94K | |
| Quantum computation ..> | 12-Sep-2005 11:30 | 131K | |
| Quantum entanglement..> | 12-Sep-2005 11:30 | 116K | |
| Quantum entanglement..> | 21-Dec-2006 09:10 | 220K | |
| Quantum limit on com..> | 12-Sep-2005 11:30 | 97K | |
| Quantum physics from..> | 07-Mar-2007 08:33 | 84K | |
| Quantum simulations ..> | 12-Sep-2005 11:30 | 279K | |
| Rank and bound entan..> | 26-Apr-2006 13:46 | 113K | |
| Relativistic invaria..> | 12-Sep-2005 11:30 | 61K | |
| Relativity of Pure S..> | 12-Sep-2005 11:30 | 293K | |
| Relativity of Pure S..> | 12-Sep-2005 11:30 | 1.2K | |
| RevModPhys_77_000513..> | 29-Sep-2006 10:16 | 576K | |
| RevModPhys_77_001225..> | 29-Sep-2006 10:16 | 540K | |
| Ropse.pdf | 07-Oct-2005 12:19 | 293K | |
| SINTEF nano strategy..> | 10-Oct-2006 18:26 | 417K | |
| Sammenfiltring/ | 12-Sep-2005 11:30 | - | |
| Scfdm.pdf | 07-Oct-2005 14:04 | 98K | |
| Separability criteri..> | 14-Mar-2007 09:52 | 604K | |
| Separability criteri..> | 12-Sep-2005 11:30 | 98K | |
| Separability of mixe..> | 12-Sep-2005 11:30 | 126K | |
| Simulation of n-qubi..> | 21-Dec-2006 09:09 | 400K | |
| Soms.pdf | 07-Oct-2005 11:30 | 126K | |
| TensorProductsofConv..> | 17-Nov-2005 11:12 | 269K | |
| The Importance of Be..> | 12-Sep-2005 11:30 | 92K | |
| The asymptotic entan..> | 12-Sep-2005 11:30 | 142K | |
| The geometry of enta..> | 12-Sep-2005 11:32 | 287K | |
| The geometry of enta..> | 12-Sep-2005 11:32 | 253K | |
| Thermodynamical Appr..> | 12-Sep-2005 11:30 | 85K | |
| Thermodynamical dete..> | 12-Sep-2005 11:30 | 134K | |
| Thermodynamics and t..> | 12-Sep-2005 11:30 | 67K | |
| The standard model o..> | 12-Sep-2005 11:29 | 659K | |
| Thumbs.db | 12-Sep-2005 11:30 | 5.0K | |
| Towards a unificatio..> | 12-Sep-2005 11:30 | 134K | |
| Unextendible product..> | 24-Aug-2006 08:55 | 66K | |
| Uniqueness kladd.pdf | 12-Sep-2005 11:32 | 275K | |
| Uniqueness of Entang..> | 12-Sep-2005 11:30 | 95K | |
| Uniqueness theorem.pdf | 12-Sep-2005 11:32 | 196K | |
| Volume of the set of..> | 12-Sep-2005 11:32 | 243K | |
| Volume of the set of..> | 12-Sep-2005 11:32 | 227K | |
| Warpdrive/ | 12-Sep-2005 11:29 | - | |
| Why is Space Three-D..> | 12-Sep-2005 11:30 | 146K | |
| ZeilingerEntangledEn..> | 07-Aug-2006 15:44 | 727K | |
| _PRL37902.ps.gz_ | 12-Sep-2005 11:30 | 171K | |
| a.pdf | 04-May-2006 15:56 | 113K | |
| avhandling.pdf | 22-May-2007 08:58 | 1.1M | |
| classical Simulation..> | 19-Sep-2006 09:00 | 320K | |
| class of bound entan..> | 08-Jan-2007 14:57 | 270K | |
| class of ppte states..> | 19-Jan-2007 09:38 | 267K | |
| des2005AlgoEnt.pdf | 12-Dec-2005 15:09 | 102K | |
| des2005OptimalEWBert..> | 14-Dec-2005 13:10 | 252K | |
| des2005QuantumAndCla..> | 13-Dec-2005 12:09 | 129K | |
| deutsch85.pdf | 12-Sep-2005 11:30 | 196K | |
| dilbert-dt970322_295..> | 12-Sep-2005 11:30 | 16K | |
| e022319.pdf | 10-Oct-2006 14:24 | 166K | |
| efficientHamiltonian..> | 17-Nov-2006 09:39 | 110K | |
| entanglementOfFormat..> | 12-Sep-2005 11:32 | - | |
| errata.pdf | 12-Sep-2005 11:30 | 97K | |
| error.tex | 12-Sep-2005 11:47 | 5.2K | |
| extremePoints.pdf | 26-Apr-2007 09:26 | 238K | |
| fulltext | 04-Sep-2006 10:09 | 1.3M | |
| geometricQC | 12-Sep-2005 11:30 | 142K | |
| goodQubitIntro.pdf | 19-Mar-2007 13:22 | 97K | |
| jankothesis.ps | 12-Sep-2005 11:29 | 1.7M | |
| kommando.aux | 12-Sep-2005 12:08 | 478 | |
| kommando.tex | 12-Sep-2005 11:46 | 844 | |
| kommentarer.aux | 12-Sep-2005 12:08 | 262 | |
| kommentarer.bbl | 12-Sep-2005 12:08 | 0 | |
| kommentarer.blg | 12-Sep-2005 12:08 | 1.0K | |
| kommentarer.dvi | 12-Sep-2005 12:08 | 10K | |
| kommentarer.log | 12-Sep-2005 12:08 | 8.5K | |
| kommentarer.ps | 12-Sep-2005 12:08 | 444K | |
| kommentarer.tex | 12-Sep-2005 12:13 | 7.8K | |
| kvantedata fra lanl/ | 12-Sep-2005 11:30 | - | |
| lanl 14.11.2002/ | 12-Sep-2005 11:30 | - | |
| leggetMacroEntanglem..> | 04-Sep-2006 08:48 | 253K | |
| linalgArticle.pdf | 26-Apr-2007 13:07 | 181K | |
| lloyd/ | 12-Sep-2005 11:30 | - | |
| monotonePetz.pdf | 12-Sep-2005 11:30 | 551K | |
| moorespaper.pdf | 12-Sep-2005 11:30 | 168K | |
| ntanglement witnesse..> | 12-Sep-2005 11:30 | 252K | |
| on the structure of ..> | 19-Jan-2007 14:23 | 152K | |
| open quantum dynamic..> | 29-Sep-2005 15:36 | 631K | |
| pairing.pdf | 04-Sep-2006 10:02 | 111K | |
| pairingNMR.pdf | 04-Sep-2006 10:03 | 162K | |
| photoSynthQC | 12-Sep-2005 11:30 | 114K | |
| preamble.aux | 12-Sep-2005 12:08 | 478 | |
| preamble.tex | 12-Sep-2005 11:48 | 696 | |
| printfile.ps | 12-Sep-2005 11:30 | 167K | |
| qcSimulatorMaple.pdf | 28-Mar-2006 13:17 | 218K | |
| qcomp.ps.gz | 12-Sep-2005 11:30 | 105K | |
| quantumSimulator.pdf | 14-May-2007 14:46 | 303K | |
| qubus.pdf | 02-Oct-2006 10:35 | 312K | |
| rebit.pdf | 12-Apr-2007 11:24 | 642K | |
| sdarticleMine.pdf | 18-Apr-2007 14:14 | 181K | |
| sepAlgo2005.pdf | 07-Nov-2005 12:48 | 122K | |
| sommaThesis.pdf | 19-Mar-2007 14:21 | 2.0M | |
| theoryQuantumComp | 12-Sep-2005 11:30 | 28K | |
| titlepage.aux | 12-Sep-2005 12:08 | 479 | |
| vis.php | 14-May-2007 16:32 | 898K | |
| warpdrive.pdf | 12-Sep-2005 11:29 | 340 | |
| warpdrive.ps | 12-Sep-2005 11:29 | 41K | |
| x.log | 12-Sep-2005 11:48 | 695 | |